C40H44O5 — CID 175657158
2-[2-[(2R,3S,5S,6R)-6-butyl-5-(4-phenylphenyl)-3-prop-1-en-2-yloxan-2-yl]-4-(3,5-dimethylphenoxy)phenoxy]acetic acid (PubChem CID 175657158) has the molecular formula C40H44O5 and a molecular weight of 604.79 g/mol. Its IUPAC name is 2-[2-[(2R,3S,5S,6R)-6-butyl-5-(4-phenylphenyl)-3-prop-1-en-2-yloxan-2-yl]-4-(3,5-dimethylphenoxy)phenoxy]acetic acid.
| Compound Name | 2-[2-[(2R,3S,5S,6R)-6-butyl-5-(4-phenylphenyl)-3-prop-1-en-2-yloxan-2-yl]-4-(3,5-dimethylphenoxy)phenoxy]acetic acid |
|---|---|
| PubChem CID | 175657158 |
| Molecular Formula | C40H44O5 |
| Molecular Weight | 604.79 g/mol |
| Exact Mass | 604.32 |
| IUPAC Name | 2-[2-[(2R,3S,5S,6R)-6-butyl-5-(4-phenylphenyl)-3-prop-1-en-2-yloxan-2-yl]-4-(3,5-dimethylphenoxy)phenoxy]acetic acid |
| SMILES | C=C(C)[C@@H]1C[C@@H](c2ccc(-c3ccccc3)cc2)[C@@H](CCCC)O[C@H]1c1cc(Oc2cc(C)cc(C)c2)ccc1OCC(=O)O |
| InChI | InChI=1S/C40H44O5/c1-6-7-13-38-35(31-16-14-30(15-17-31)29-11-9-8-10-12-29)24-34(26(2)3)40(45-38)36-23-32(18-19-37(36)43-25-39(41)42)44-33-21-27(4)20-28(5)22-33/h8-12,14-23,34-35,38,40H,2,6-7,13,24-25H2,1,3-5H3,(H,41,42)/t34-,35-,38+,40+/m0/s1 |
| InChIKey | GFCVVJSOCVJTAP-MUXLNHAWSA-N |
| XLogP | 10.22 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.79 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|