C42H49NO9S — CID 175655171
2-[2-[(2R,3S,5S,6R)-6-butyl-5-[2-methoxy-5-[methyl(2-phenoxyethyl)sulfamoyl]phenyl]-3-prop-1-en-2-yloxan-2-yl]-4-phenoxyphenoxy]acetic acid (PubChem CID 175655171) has the molecular formula C42H49NO9S and a molecular weight of 743.92 g/mol. Its IUPAC name is 2-[2-[(2R,3S,5S,6R)-6-butyl-5-[2-methoxy-5-[methyl(2-phenoxyethyl)sulfamoyl]phenyl]-3-prop-1-en-2-yloxan-2-yl]-4-phenoxyphenoxy]acetic acid.
| Compound Name | 2-[2-[(2R,3S,5S,6R)-6-butyl-5-[2-methoxy-5-[methyl(2-phenoxyethyl)sulfamoyl]phenyl]-3-prop-1-en-2-yloxan-2-yl]-4-phenoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 175655171 |
| Molecular Formula | C42H49NO9S |
| Molecular Weight | 743.92 g/mol |
| Exact Mass | 743.31 |
| IUPAC Name | 2-[2-[(2R,3S,5S,6R)-6-butyl-5-[2-methoxy-5-[methyl(2-phenoxyethyl)sulfamoyl]phenyl]-3-prop-1-en-2-yloxan-2-yl]-4-phenoxyphenoxy]acetic acid |
| SMILES | C=C(C)[C@@H]1C[C@@H](c2cc(S(=O)(=O)N(C)CCOc3ccccc3)ccc2OC)[C@@H](CCCC)O[C@H]1c1cc(Oc2ccccc2)ccc1OCC(=O)O |
| InChI | InChI=1S/C42H49NO9S/c1-6-7-18-40-36(35-26-33(20-22-38(35)48-5)53(46,47)43(4)23-24-49-30-14-10-8-11-15-30)27-34(29(2)3)42(52-40)37-25-32(51-31-16-12-9-13-17-31)19-21-39(37)50-28-41(44)45/h8-17,19-22,25-26,34,36,40,42H,2,6-7,18,23-24,27-28H2,1,3-5H3,(H,44,45)/t34-,36-,40+,42+/m0/s1 |
| InChIKey | OAXQVTNPFKAKJT-QDLLHZFWSA-N |
| XLogP | 8.65 |
| TPSA | 120.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.92 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|