C39H40ClNO7S — CID 175659279
2-[2-[(2R,3S,4aR,8aR)-6-(4-phenylphenyl)sulfonyl-3-prop-1-en-2-yl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-2-yl]-4-(4-chloro-3,5-dimethylphenoxy)phenoxy]acetic acid (PubChem CID 175659279) has the molecular formula C39H40ClNO7S and a molecular weight of 702.27 g/mol. Its IUPAC name is 2-[2-[(2R,3S,4aR,8aR)-6-(4-phenylphenyl)sulfonyl-3-prop-1-en-2-yl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-2-yl]-4-(4-chloro-3,5-dimethylphenoxy)phenoxy]acetic acid.
| Compound Name | 2-[2-[(2R,3S,4aR,8aR)-6-(4-phenylphenyl)sulfonyl-3-prop-1-en-2-yl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-2-yl]-4-(4-chloro-3,5-dimethylphenoxy)phenoxy]acetic acid |
|---|---|
| PubChem CID | 175659279 |
| Molecular Formula | C39H40ClNO7S |
| Molecular Weight | 702.27 g/mol |
| Exact Mass | 701.22 |
| IUPAC Name | 2-[2-[(2R,3S,4aR,8aR)-6-(4-phenylphenyl)sulfonyl-3-prop-1-en-2-yl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-2-yl]-4-(4-chloro-3,5-dimethylphenoxy)phenoxy]acetic acid |
| SMILES | C=C(C)[C@@H]1C[C@@H]2CN(S(=O)(=O)c3ccc(-c4ccccc4)cc3)CC[C@H]2O[C@H]1c1cc(Oc2cc(C)c(Cl)c(C)c2)ccc1OCC(=O)O |
| InChI | InChI=1S/C39H40ClNO7S/c1-24(2)33-20-29-22-41(49(44,45)32-13-10-28(11-14-32)27-8-6-5-7-9-27)17-16-35(29)48-39(33)34-21-30(12-15-36(34)46-23-37(42)43)47-31-18-25(3)38(40)26(4)19-31/h5-15,18-19,21,29,33,35,39H,1,16-17,20,22-23H2,2-4H3,(H,42,43)/t29-,33+,35-,39-/m1/s1 |
| InChIKey | PVQFJUTWHFTXFS-MAMMWHARSA-N |
| XLogP | 8.61 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.27 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|