C25H28ClFO4 — CID 155988991
2-[2-[(2S,3R,5R,6S)-5-(4-chlorophenyl)-3-prop-1-en-2-yl-6-propyloxan-2-yl]-6-fluorophenoxy]acetic acid (PubChem CID 155988991) has the molecular formula C25H28ClFO4 and a molecular weight of 446.95 g/mol. Its IUPAC name is 2-[2-[(2S,3R,5R,6S)-5-(4-chlorophenyl)-3-prop-1-en-2-yl-6-propyloxan-2-yl]-6-fluorophenoxy]acetic acid.
| Compound Name | 2-[2-[(2S,3R,5R,6S)-5-(4-chlorophenyl)-3-prop-1-en-2-yl-6-propyloxan-2-yl]-6-fluorophenoxy]acetic acid |
|---|---|
| PubChem CID | 155988991 |
| Molecular Formula | C25H28ClFO4 |
| Molecular Weight | 446.95 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 2-[2-[(2S,3R,5R,6S)-5-(4-chlorophenyl)-3-prop-1-en-2-yl-6-propyloxan-2-yl]-6-fluorophenoxy]acetic acid |
| SMILES | C=C(C)[C@H]1C[C@H](c2ccc(Cl)cc2)[C@H](CCC)O[C@@H]1c1cccc(F)c1OCC(=O)O |
| InChI | InChI=1S/C25H28ClFO4/c1-4-6-22-20(16-9-11-17(26)12-10-16)13-19(15(2)3)24(31-22)18-7-5-8-21(27)25(18)30-14-23(28)29/h5,7-12,19-20,22,24H,2,4,6,13-14H2,1,3H3,(H,28,29)/t19-,20-,22+,24-/m1/s1 |
| InChIKey | QCQFIOIIPRGLOE-ZBJYJBBSSA-N |
| XLogP | 6.55 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.95 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|