C25H29BrO4 — CID 155989056
2-[2-bromo-6-[(2S,3R,5R,6S)-5-(4-ethylphenyl)-6-methyl-3-prop-1-en-2-yloxan-2-yl]phenoxy]acetic acid (PubChem CID 155989056) has the molecular formula C25H29BrO4 and a molecular weight of 473.41 g/mol. Its IUPAC name is 2-[2-bromo-6-[(2S,3R,5R,6S)-5-(4-ethylphenyl)-6-methyl-3-prop-1-en-2-yloxan-2-yl]phenoxy]acetic acid.
| Compound Name | 2-[2-bromo-6-[(2S,3R,5R,6S)-5-(4-ethylphenyl)-6-methyl-3-prop-1-en-2-yloxan-2-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 155989056 |
| Molecular Formula | C25H29BrO4 |
| Molecular Weight | 473.41 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | 2-[2-bromo-6-[(2S,3R,5R,6S)-5-(4-ethylphenyl)-6-methyl-3-prop-1-en-2-yloxan-2-yl]phenoxy]acetic acid |
| SMILES | C=C(C)[C@H]1C[C@H](c2ccc(CC)cc2)[C@H](C)O[C@@H]1c1cccc(Br)c1OCC(=O)O |
| InChI | InChI=1S/C25H29BrO4/c1-5-17-9-11-18(12-10-17)21-13-20(15(2)3)24(30-16(21)4)19-7-6-8-22(26)25(19)29-14-23(27)28/h6-12,16,20-21,24H,2,5,13-14H2,1,3-4H3,(H,27,28)/t16-,20+,21-,24+/m0/s1 |
| InChIKey | PXBSGIHOIPWVEO-OEZJKNOUSA-N |
| XLogP | 6.30 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.41 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|