C26H32O5 — CID 175656944
2-[2-[(2S,3S,5R,6S)-5-(2,4-dimethylphenyl)-6-methyl-3-prop-1-en-2-yloxan-2-yl]-6-methoxyphenoxy]acetic acid (PubChem CID 175656944) has the molecular formula C26H32O5 and a molecular weight of 424.54 g/mol. Its IUPAC name is 2-[2-[(2S,3S,5R,6S)-5-(2,4-dimethylphenyl)-6-methyl-3-prop-1-en-2-yloxan-2-yl]-6-methoxyphenoxy]acetic acid.
| Compound Name | 2-[2-[(2S,3S,5R,6S)-5-(2,4-dimethylphenyl)-6-methyl-3-prop-1-en-2-yloxan-2-yl]-6-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 175656944 |
| Molecular Formula | C26H32O5 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 2-[2-[(2S,3S,5R,6S)-5-(2,4-dimethylphenyl)-6-methyl-3-prop-1-en-2-yloxan-2-yl]-6-methoxyphenoxy]acetic acid |
| SMILES | C=C(C)[C@@H]1C[C@H](c2ccc(C)cc2C)[C@H](C)O[C@@H]1c1cccc(OC)c1OCC(=O)O |
| InChI | InChI=1S/C26H32O5/c1-15(2)21-13-22(19-11-10-16(3)12-17(19)4)18(5)31-25(21)20-8-7-9-23(29-6)26(20)30-14-24(27)28/h7-12,18,21-22,25H,1,13-14H2,2-6H3,(H,27,28)/t18-,21-,22-,25+/m0/s1 |
| InChIKey | RYYXAEWISZOIPP-OPQSODGTSA-N |
| XLogP | 5.60 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|