C25H27FO4 — CID 155988937
2-[2-fluoro-6-[(2R,4R,5S,7S)-4-prop-1-en-2-yl-6-oxatricyclo[9.4.0.02,7]pentadeca-1(15),11,13-trien-5-yl]phenoxy]acetic acid (PubChem CID 155988937) has the molecular formula C25H27FO4 and a molecular weight of 410.49 g/mol. Its IUPAC name is 2-[2-fluoro-6-[(2R,4R,5S,7S)-4-prop-1-en-2-yl-6-oxatricyclo[9.4.0.02,7]pentadeca-1(15),11,13-trien-5-yl]phenoxy]acetic acid.
| Compound Name | 2-[2-fluoro-6-[(2R,4R,5S,7S)-4-prop-1-en-2-yl-6-oxatricyclo[9.4.0.02,7]pentadeca-1(15),11,13-trien-5-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 155988937 |
| Molecular Formula | C25H27FO4 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 2-[2-fluoro-6-[(2R,4R,5S,7S)-4-prop-1-en-2-yl-6-oxatricyclo[9.4.0.02,7]pentadeca-1(15),11,13-trien-5-yl]phenoxy]acetic acid |
| SMILES | C=C(C)[C@H]1C[C@@H]2c3ccccc3CCC[C@@H]2O[C@@H]1c1cccc(F)c1OCC(=O)O |
| InChI | InChI=1S/C25H27FO4/c1-15(2)19-13-20-17-9-4-3-7-16(17)8-5-12-22(20)30-24(19)18-10-6-11-21(26)25(18)29-14-23(27)28/h3-4,6-7,9-11,19-20,22,24H,1,5,8,12-14H2,2H3,(H,27,28)/t19-,20-,22+,24-/m1/s1 |
| InChIKey | HGOSDPFFFSLCFT-ZBJYJBBSSA-N |
| XLogP | 5.43 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|