C24H27ClO4 — CID 110146250
2-[(2S,3S,4aS,10bS)-3-(3-chlorophenyl)-2-ethyl-5,5-dimethyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromen-9-yl]acetic acid (PubChem CID 110146250) has the molecular formula C24H27ClO4 and a molecular weight of 414.93 g/mol. Its IUPAC name is 2-[(2S,3S,4aS,10bS)-3-(3-chlorophenyl)-2-ethyl-5,5-dimethyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromen-9-yl]acetic acid.
| Compound Name | 2-[(2S,3S,4aS,10bS)-3-(3-chlorophenyl)-2-ethyl-5,5-dimethyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromen-9-yl]acetic acid |
|---|---|
| PubChem CID | 110146250 |
| Molecular Formula | C24H27ClO4 |
| Molecular Weight | 414.93 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 2-[(2S,3S,4aS,10bS)-3-(3-chlorophenyl)-2-ethyl-5,5-dimethyl-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromen-9-yl]acetic acid |
| SMILES | CC[C@@H]1O[C@@H]2c3cc(CC(=O)O)ccc3OC(C)(C)[C@H]2C[C@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H27ClO4/c1-4-20-17(15-6-5-7-16(25)12-15)13-19-23(28-20)18-10-14(11-22(26)27)8-9-21(18)29-24(19,2)3/h5-10,12,17,19-20,23H,4,11,13H2,1-3H3,(H,26,27)/t17-,19-,20-,23+/m0/s1 |
| InChIKey | SREARQPRSQQONU-QUZFRVLNSA-N |
| XLogP | 5.78 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.93 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |