C30H39NO3 — CID 129455349
2-[[(2S,4aS,10bS)-2,5,5-trimethyl-9-(3-methylbut-2-enoxy)-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromen-8-yl]methyl]-3,4-dihydro-1H-isoquinoline (PubChem CID 129455349) has the molecular formula C30H39NO3 and a molecular weight of 461.65 g/mol. Its IUPAC name is 2-[[(2S,4aS,10bS)-2,5,5-trimethyl-9-(3-methylbut-2-enoxy)-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromen-8-yl]methyl]-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-[[(2S,4aS,10bS)-2,5,5-trimethyl-9-(3-methylbut-2-enoxy)-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromen-8-yl]methyl]-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 129455349 |
| Molecular Formula | C30H39NO3 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.29 |
| IUPAC Name | 2-[[(2S,4aS,10bS)-2,5,5-trimethyl-9-(3-methylbut-2-enoxy)-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]chromen-8-yl]methyl]-3,4-dihydro-1H-isoquinoline |
| SMILES | CC(C)=CCOc1cc2c(cc1CN1CCc3ccccc3C1)OC(C)(C)[C@H]1CC[C@H](C)O[C@H]21 |
| InChI | InChI=1S/C30H39NO3/c1-20(2)13-15-32-27-17-25-28(34-30(4,5)26-11-10-21(3)33-29(25)26)16-24(27)19-31-14-12-22-8-6-7-9-23(22)18-31/h6-9,13,16-17,21,26,29H,10-12,14-15,18-19H2,1-5H3/t21-,26-,29+/m0/s1 |
| InChIKey | IAJDRFRSALFFMP-YRKLHJTHSA-N |
| XLogP | 6.62 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|