C16H16O3 — CID 79014406
(4S)-6-phenylmethoxy-3,4-dihydro-2H-chromen-4-ol (PubChem CID 79014406) has the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. Its IUPAC name is (4S)-6-phenylmethoxy-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (4S)-6-phenylmethoxy-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 79014406 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | (4S)-6-phenylmethoxy-3,4-dihydro-2H-chromen-4-ol |
| SMILES | O[C@H]1CCOc2ccc(OCc3ccccc3)cc21 |
| InChI | InChI=1S/C16H16O3/c17-15-8-9-18-16-7-6-13(10-14(15)16)19-11-12-4-2-1-3-5-12/h1-7,10,15,17H,8-9,11H2/t15-/m0/s1 |
| InChIKey | TUUBEMGTMDQEAF-HNNXBMFYSA-N |
| XLogP | 3.08 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |