C17H18ClNO4 — CID 171185405
(4R)-4-(2-hydroxy-4-phenylmethoxyphenyl)-1,3-oxazinan-2-one;hydrochloride (PubChem CID 171185405) has the molecular formula C17H18ClNO4 and a molecular weight of 335.79 g/mol. Its IUPAC name is (4R)-4-(2-hydroxy-4-phenylmethoxyphenyl)-1,3-oxazinan-2-one;hydrochloride.
| Compound Name | (4R)-4-(2-hydroxy-4-phenylmethoxyphenyl)-1,3-oxazinan-2-one;hydrochloride |
|---|---|
| PubChem CID | 171185405 |
| Molecular Formula | C17H18ClNO4 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | (4R)-4-(2-hydroxy-4-phenylmethoxyphenyl)-1,3-oxazinan-2-one;hydrochloride |
| SMILES | Cl.O=C1N[C@@H](c2ccc(OCc3ccccc3)cc2O)CCO1 |
| InChI | InChI=1S/C17H17NO4.ClH/c19-16-10-13(22-11-12-4-2-1-3-5-12)6-7-14(16)15-8-9-21-17(20)18-15;/h1-7,10,15,19H,8-9,11H2,(H,18,20);1H/t15-;/m1./s1 |
| InChIKey | HTJYHSSFQZNIMH-XFULWGLBSA-N |
| XLogP | 3.56 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|