C10H12ClNO3 — CID 171185449
(4S)-4-(3-hydroxyphenyl)-1,3-oxazinan-2-one;hydrochloride (PubChem CID 171185449) has the molecular formula C10H12ClNO3 and a molecular weight of 229.66 g/mol. Its IUPAC name is (4S)-4-(3-hydroxyphenyl)-1,3-oxazinan-2-one;hydrochloride.
| Compound Name | (4S)-4-(3-hydroxyphenyl)-1,3-oxazinan-2-one;hydrochloride |
|---|---|
| PubChem CID | 171185449 |
| Molecular Formula | C10H12ClNO3 |
| Molecular Weight | 229.66 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | (4S)-4-(3-hydroxyphenyl)-1,3-oxazinan-2-one;hydrochloride |
| SMILES | Cl.O=C1N[C@H](c2cccc(O)c2)CCO1 |
| InChI | InChI=1S/C10H11NO3.ClH/c12-8-3-1-2-7(6-8)9-4-5-14-10(13)11-9;/h1-3,6,9,12H,4-5H2,(H,11,13);1H/t9-;/m0./s1 |
| InChIKey | JBJOAGMPKICNRC-FVGYRXGTSA-N |
| XLogP | 1.99 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.66 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |