C10H11NO4 — CID 131484936
(4S)-4-(2,5-dihydroxyphenyl)-1,3-oxazinan-2-one (PubChem CID 131484936) has the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. Its IUPAC name is (4S)-4-(2,5-dihydroxyphenyl)-1,3-oxazinan-2-one.
| Compound Name | (4S)-4-(2,5-dihydroxyphenyl)-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 131484936 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | (4S)-4-(2,5-dihydroxyphenyl)-1,3-oxazinan-2-one |
| SMILES | O=C1N[C@H](c2cc(O)ccc2O)CCO1 |
| InChI | InChI=1S/C10H11NO4/c12-6-1-2-9(13)7(5-6)8-3-4-15-10(14)11-8/h1-2,5,8,12-13H,3-4H2,(H,11,14)/t8-/m0/s1 |
| InChIKey | PETHGKHIYJLCCC-QMMMGPOBSA-N |
| XLogP | 1.27 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|