C10H12N2O2 — CID 105445856
4-(3-hydroxyphenyl)-1,3-diazinan-2-one (PubChem CID 105445856) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 4-(3-hydroxyphenyl)-1,3-diazinan-2-one.
| Compound Name | 4-(3-hydroxyphenyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 105445856 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 4-(3-hydroxyphenyl)-1,3-diazinan-2-one |
| SMILES | O=C1NCCC(c2cccc(O)c2)N1 |
| InChI | InChI=1S/C10H12N2O2/c13-8-3-1-2-7(6-8)9-4-5-11-10(14)12-9/h1-3,6,9,13H,4-5H2,(H2,11,12,14) |
| InChIKey | ZBNGGOGTYOQAEV-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |