C18H18O4 — CID 69379697
[(4S)-7-phenylmethoxy-3,4-dihydro-2H-chromen-4-yl] acetate (PubChem CID 69379697) has the molecular formula C18H18O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is [(4S)-7-phenylmethoxy-3,4-dihydro-2H-chromen-4-yl] acetate.
| Compound Name | [(4S)-7-phenylmethoxy-3,4-dihydro-2H-chromen-4-yl] acetate |
|---|---|
| PubChem CID | 69379697 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | [(4S)-7-phenylmethoxy-3,4-dihydro-2H-chromen-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCOc2cc(OCc3ccccc3)ccc21 |
| InChI | InChI=1S/C18H18O4/c1-13(19)22-17-9-10-20-18-11-15(7-8-16(17)18)21-12-14-5-3-2-4-6-14/h2-8,11,17H,9-10,12H2,1H3/t17-/m0/s1 |
| InChIKey | RPHWQNHOKSBPFQ-KRWDZBQOSA-N |
| XLogP | 3.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |