C14H18O3 — CID 129385470
(1aS,7bR)-2,2-dimethyl-6-propoxy-1a,7b-dihydrooxireno[2,3-c]chromene (PubChem CID 129385470) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is (1aS,7bR)-2,2-dimethyl-6-propoxy-1a,7b-dihydrooxireno[2,3-c]chromene.
| Compound Name | (1aS,7bR)-2,2-dimethyl-6-propoxy-1a,7b-dihydrooxireno[2,3-c]chromene |
|---|---|
| PubChem CID | 129385470 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (1aS,7bR)-2,2-dimethyl-6-propoxy-1a,7b-dihydrooxireno[2,3-c]chromene |
| SMILES | CCCOc1ccc2c(c1)[C@H]1O[C@@H]1C(C)(C)O2 |
| InChI | InChI=1S/C14H18O3/c1-4-7-15-9-5-6-11-10(8-9)12-13(16-12)14(2,3)17-11/h5-6,8,12-13H,4,7H2,1-3H3/t12-,13+/m1/s1 |
| InChIKey | RTIZJZZWGMWEKB-OLZOCXBDSA-N |
| XLogP | 3.09 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|