C12H14O3 — CID 135080425
(2,2-dimethyl-1a,7b-dihydrooxireno[2,3-c]chromen-6-yl)methanol (PubChem CID 135080425) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is (2,2-dimethyl-1a,7b-dihydrooxireno[2,3-c]chromen-6-yl)methanol.
| Compound Name | (2,2-dimethyl-1a,7b-dihydrooxireno[2,3-c]chromen-6-yl)methanol |
|---|---|
| PubChem CID | 135080425 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (2,2-dimethyl-1a,7b-dihydrooxireno[2,3-c]chromen-6-yl)methanol |
| SMILES | CC1(C)Oc2ccc(CO)cc2C2OC21 |
| InChI | InChI=1S/C12H14O3/c1-12(2)11-10(14-11)8-5-7(6-13)3-4-9(8)15-12/h3-5,10-11,13H,6H2,1-2H3 |
| InChIKey | GFSKSSBBSVPEQX-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|