C14H19NO5S — CID 141324871
(1aR,7bR)-N-(2-hydroxyethyl)-N,2,2-trimethyl-1a,7b-dihydrooxireno[2,3-c]chromene-6-sulfonamide (PubChem CID 141324871) has the molecular formula C14H19NO5S and a molecular weight of 313.38 g/mol. Its IUPAC name is (1aR,7bR)-N-(2-hydroxyethyl)-N,2,2-trimethyl-1a,7b-dihydrooxireno[2,3-c]chromene-6-sulfonamide.
| Compound Name | (1aR,7bR)-N-(2-hydroxyethyl)-N,2,2-trimethyl-1a,7b-dihydrooxireno[2,3-c]chromene-6-sulfonamide |
|---|---|
| PubChem CID | 141324871 |
| Molecular Formula | C14H19NO5S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | (1aR,7bR)-N-(2-hydroxyethyl)-N,2,2-trimethyl-1a,7b-dihydrooxireno[2,3-c]chromene-6-sulfonamide |
| SMILES | CN(CCO)S(=O)(=O)c1ccc2c(c1)[C@H]1O[C@H]1C(C)(C)O2 |
| InChI | InChI=1S/C14H19NO5S/c1-14(2)13-12(19-13)10-8-9(4-5-11(10)20-14)21(17,18)15(3)6-7-16/h4-5,8,12-13,16H,6-7H2,1-3H3/t12-,13-/m1/s1 |
| InChIKey | VHAXVTPUVBYZSI-CHWSQXEVSA-N |
| XLogP | 0.91 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|