C10H14ClNO3S — CID 39363651
4-chloro-N-(2-hydroxyethyl)-N,3-dimethylbenzenesulfonamide (PubChem CID 39363651) has the molecular formula C10H14ClNO3S and a molecular weight of 263.75 g/mol. Its IUPAC name is 4-chloro-N-(2-hydroxyethyl)-N,3-dimethylbenzenesulfonamide.
| Compound Name | 4-chloro-N-(2-hydroxyethyl)-N,3-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 39363651 |
| Molecular Formula | C10H14ClNO3S |
| Molecular Weight | 263.75 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 4-chloro-N-(2-hydroxyethyl)-N,3-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N(C)CCO)ccc1Cl |
| InChI | InChI=1S/C10H14ClNO3S/c1-8-7-9(3-4-10(8)11)16(14,15)12(2)5-6-13/h3-4,7,13H,5-6H2,1-2H3 |
| InChIKey | YCNIEAYCXABYKR-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.75 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |