C11H13ClN2O2S — CID 39371978
4-chloro-N-(2-cyanoethyl)-N,3-dimethylbenzenesulfonamide (PubChem CID 39371978) has the molecular formula C11H13ClN2O2S and a molecular weight of 272.76 g/mol. Its IUPAC name is 4-chloro-N-(2-cyanoethyl)-N,3-dimethylbenzenesulfonamide.
| Compound Name | 4-chloro-N-(2-cyanoethyl)-N,3-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 39371978 |
| Molecular Formula | C11H13ClN2O2S |
| Molecular Weight | 272.76 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 4-chloro-N-(2-cyanoethyl)-N,3-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N(C)CCC#N)ccc1Cl |
| InChI | InChI=1S/C11H13ClN2O2S/c1-9-8-10(4-5-11(9)12)17(15,16)14(2)7-3-6-13/h4-5,8H,3,7H2,1-2H3 |
| InChIKey | RVUPJJQPKQEPBU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.76 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |