C12H16N2O4S2 — CID 106833221
4-cyano-N,3-dimethyl-N-(2-methylsulfonylethyl)benzenesulfonamide (PubChem CID 106833221) has the molecular formula C12H16N2O4S2 and a molecular weight of 316.40 g/mol. Its IUPAC name is 4-cyano-N,3-dimethyl-N-(2-methylsulfonylethyl)benzenesulfonamide.
| Compound Name | 4-cyano-N,3-dimethyl-N-(2-methylsulfonylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106833221 |
| Molecular Formula | C12H16N2O4S2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 4-cyano-N,3-dimethyl-N-(2-methylsulfonylethyl)benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N(C)CCS(C)(=O)=O)ccc1C#N |
| InChI | InChI=1S/C12H16N2O4S2/c1-10-8-12(5-4-11(10)9-13)20(17,18)14(2)6-7-19(3,15)16/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | JMBKPODAMACIFG-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 95.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |