C15H22N2O2S — CID 106833012
4-cyano-N,3-dimethyl-N-(4-methylpentan-2-yl)benzenesulfonamide (PubChem CID 106833012) has the molecular formula C15H22N2O2S and a molecular weight of 294.42 g/mol. Its IUPAC name is 4-cyano-N,3-dimethyl-N-(4-methylpentan-2-yl)benzenesulfonamide.
| Compound Name | 4-cyano-N,3-dimethyl-N-(4-methylpentan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 106833012 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 4-cyano-N,3-dimethyl-N-(4-methylpentan-2-yl)benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N(C)C(C)CC(C)C)ccc1C#N |
| InChI | InChI=1S/C15H22N2O2S/c1-11(2)8-13(4)17(5)20(18,19)15-7-6-14(10-16)12(3)9-15/h6-7,9,11,13H,8H2,1-5H3 |
| InChIKey | GHBYLZITTZCSAC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |