C16H24N2O2S — CID 106833094
4-cyano-3-methyl-N,N-bis(2-methylpropyl)benzenesulfonamide (PubChem CID 106833094) has the molecular formula C16H24N2O2S and a molecular weight of 308.45 g/mol. Its IUPAC name is 4-cyano-3-methyl-N,N-bis(2-methylpropyl)benzenesulfonamide.
| Compound Name | 4-cyano-3-methyl-N,N-bis(2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106833094 |
| Molecular Formula | C16H24N2O2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 4-cyano-3-methyl-N,N-bis(2-methylpropyl)benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N(CC(C)C)CC(C)C)ccc1C#N |
| InChI | InChI=1S/C16H24N2O2S/c1-12(2)10-18(11-13(3)4)21(19,20)16-7-6-15(9-17)14(5)8-16/h6-8,12-13H,10-11H2,1-5H3 |
| InChIKey | HSDUMFVTQYGZGS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |