C14H18N2O4S — CID 106833054
methyl 2-[(4-cyano-3-methylphenyl)sulfonyl-propan-2-ylamino]acetate (PubChem CID 106833054) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is methyl 2-[(4-cyano-3-methylphenyl)sulfonyl-propan-2-ylamino]acetate.
| Compound Name | methyl 2-[(4-cyano-3-methylphenyl)sulfonyl-propan-2-ylamino]acetate |
|---|---|
| PubChem CID | 106833054 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | methyl 2-[(4-cyano-3-methylphenyl)sulfonyl-propan-2-ylamino]acetate |
| SMILES | COC(=O)CN(C(C)C)S(=O)(=O)c1ccc(C#N)c(C)c1 |
| InChI | InChI=1S/C14H18N2O4S/c1-10(2)16(9-14(17)20-4)21(18,19)13-6-5-12(8-15)11(3)7-13/h5-7,10H,9H2,1-4H3 |
| InChIKey | YULYYCCHNRGBEH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |