C36H48O11 — CID 70905883
[(3S,6S)-3,4-diacetyloxy-6-[(2R,4S,5S)-6-ethyl-2,5-dimethyl-3,4-bis(phenylmethoxy)oxan-2-yl]oxy-5-methyloxan-2-yl]methyl acetate (PubChem CID 70905883) has the molecular formula C36H48O11 and a molecular weight of 656.77 g/mol. Its IUPAC name is [(3S,6S)-3,4-diacetyloxy-6-[(2R,4S,5S)-6-ethyl-2,5-dimethyl-3,4-bis(phenylmethoxy)oxan-2-yl]oxy-5-methyloxan-2-yl]methyl acetate.
| Compound Name | [(3S,6S)-3,4-diacetyloxy-6-[(2R,4S,5S)-6-ethyl-2,5-dimethyl-3,4-bis(phenylmethoxy)oxan-2-yl]oxy-5-methyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 70905883 |
| Molecular Formula | C36H48O11 |
| Molecular Weight | 656.77 g/mol |
| Exact Mass | 656.32 |
| IUPAC Name | [(3S,6S)-3,4-diacetyloxy-6-[(2R,4S,5S)-6-ethyl-2,5-dimethyl-3,4-bis(phenylmethoxy)oxan-2-yl]oxy-5-methyloxan-2-yl]methyl acetate |
| SMILES | CCC1O[C@](C)(O[C@@H]2OC(COC(C)=O)[C@@H](OC(C)=O)C(OC(C)=O)C2C)C(OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1C |
| InChI | InChI=1S/C36H48O11/c1-8-29-22(2)32(41-19-27-15-11-9-12-16-27)34(42-20-28-17-13-10-14-18-28)36(7,46-29)47-35-23(3)31(43-25(5)38)33(44-26(6)39)30(45-35)21-40-24(4)37/h9-18,22-23,29-35H,8,19-21H2,1-7H3/t22-,23?,29?,30?,31?,32-,33+,34?,35-,36+/m0/s1 |
| InChIKey | UAFWQVRLDOBVAY-YUZBJUJCSA-N |
| XLogP | 5.12 |
| TPSA | 125.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.77 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|