C41H49FO12 — CID 70905889
[(3R,6S)-3,4-diacetyloxy-6-[(2R,4S,5S)-2,5-dimethyl-3,4-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-5-fluorooxan-2-yl]methyl acetate (PubChem CID 70905889) has the molecular formula C41H49FO12 and a molecular weight of 752.83 g/mol. Its IUPAC name is [(3R,6S)-3,4-diacetyloxy-6-[(2R,4S,5S)-2,5-dimethyl-3,4-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-5-fluorooxan-2-yl]methyl acetate.
| Compound Name | [(3R,6S)-3,4-diacetyloxy-6-[(2R,4S,5S)-2,5-dimethyl-3,4-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-5-fluorooxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 70905889 |
| Molecular Formula | C41H49FO12 |
| Molecular Weight | 752.83 g/mol |
| Exact Mass | 752.32 |
| IUPAC Name | [(3R,6S)-3,4-diacetyloxy-6-[(2R,4S,5S)-2,5-dimethyl-3,4-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-5-fluorooxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](O[C@@]2(C)OC(COCc3ccccc3)[C@H](C)[C@H](OCc3ccccc3)C2OCc2ccccc2)C(F)C(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C41H49FO12/c1-26-33(24-46-21-30-15-9-6-10-16-30)53-41(5,39(49-23-32-19-13-8-14-20-32)36(26)48-22-31-17-11-7-12-18-31)54-40-35(42)38(51-29(4)45)37(50-28(3)44)34(52-40)25-47-27(2)43/h6-20,26,33-40H,21-25H2,1-5H3/t26-,33?,34?,35?,36-,37+,38?,39?,40-,41+/m0/s1 |
| InChIKey | OEMFNWWVWYKIIJ-AZMQHQCKSA-N |
| XLogP | 5.63 |
| TPSA | 134.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.83 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|