C34H45FO9 — CID 70905892
[(3R,6R)-3-acetyloxy-6-[(2R,4S,5R)-6-ethyl-2,5-dimethyl-3,4-bis(phenylmethoxy)oxan-2-yl]oxy-4-fluoro-5-methyloxan-2-yl]methyl acetate (PubChem CID 70905892) has the molecular formula C34H45FO9 and a molecular weight of 616.72 g/mol. Its IUPAC name is [(3R,6R)-3-acetyloxy-6-[(2R,4S,5R)-6-ethyl-2,5-dimethyl-3,4-bis(phenylmethoxy)oxan-2-yl]oxy-4-fluoro-5-methyloxan-2-yl]methyl acetate.
| Compound Name | [(3R,6R)-3-acetyloxy-6-[(2R,4S,5R)-6-ethyl-2,5-dimethyl-3,4-bis(phenylmethoxy)oxan-2-yl]oxy-4-fluoro-5-methyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 70905892 |
| Molecular Formula | C34H45FO9 |
| Molecular Weight | 616.72 g/mol |
| Exact Mass | 616.30 |
| IUPAC Name | [(3R,6R)-3-acetyloxy-6-[(2R,4S,5R)-6-ethyl-2,5-dimethyl-3,4-bis(phenylmethoxy)oxan-2-yl]oxy-4-fluoro-5-methyloxan-2-yl]methyl acetate |
| SMILES | CCC1O[C@](C)(O[C@H]2OC(COC(C)=O)[C@@H](OC(C)=O)C(F)C2C)C(OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C34H45FO9/c1-7-27-21(2)30(39-18-25-14-10-8-11-15-25)32(40-19-26-16-12-9-13-17-26)34(6,43-27)44-33-22(3)29(35)31(41-24(5)37)28(42-33)20-38-23(4)36/h8-17,21-22,27-33H,7,18-20H2,1-6H3/t21-,22?,27?,28?,29?,30+,31-,32?,33-,34-/m1/s1 |
| InChIKey | JYHAULRTGXBWGP-IVIWQWONSA-N |
| XLogP | 5.53 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.72 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |