C29H47ClF2O5 — CID 70793036
(3R,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-chloro-2-[difluoro(phenyl)methyl]oxane (PubChem CID 70793036) has the molecular formula C29H47ClF2O5 and a molecular weight of 549.14 g/mol. Its IUPAC name is (3R,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-chloro-2-[difluoro(phenyl)methyl]oxane.
| Compound Name | (3R,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-chloro-2-[difluoro(phenyl)methyl]oxane |
|---|---|
| PubChem CID | 70793036 |
| Molecular Formula | C29H47ClF2O5 |
| Molecular Weight | 549.14 g/mol |
| Exact Mass | 548.31 |
| IUPAC Name | (3R,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-chloro-2-[difluoro(phenyl)methyl]oxane |
| SMILES | CCCCOC[C@H]1OC(Cl)(C(F)(F)c2ccccc2)[C@H](OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C29H47ClF2O5/c1-5-9-18-33-22-24-25(34-19-10-6-2)26(35-20-11-7-3)27(36-21-12-8-4)28(30,37-24)29(31,32)23-16-14-13-15-17-23/h13-17,24-27H,5-12,18-22H2,1-4H3/t24-,25-,26+,27-,28?/m1/s1 |
| InChIKey | HOWICUYCALYTSJ-GJMNKMQNSA-N |
| XLogP | 7.48 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.14 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|