C29H48O6 — CID 70860409
(3S,3'R,4'S,5'R,6'R)-3',4',5'-tributoxy-6'-(butoxymethyl)spiro[1H-2-benzofuran-3,2'-oxane] (PubChem CID 70860409) has the molecular formula C29H48O6 and a molecular weight of 492.70 g/mol. Its IUPAC name is (3S,3'R,4'S,5'R,6'R)-3',4',5'-tributoxy-6'-(butoxymethyl)spiro[1H-2-benzofuran-3,2'-oxane].
| Compound Name | (3S,3'R,4'S,5'R,6'R)-3',4',5'-tributoxy-6'-(butoxymethyl)spiro[1H-2-benzofuran-3,2'-oxane] |
|---|---|
| PubChem CID | 70860409 |
| Molecular Formula | C29H48O6 |
| Molecular Weight | 492.70 g/mol |
| Exact Mass | 492.35 |
| IUPAC Name | (3S,3'R,4'S,5'R,6'R)-3',4',5'-tributoxy-6'-(butoxymethyl)spiro[1H-2-benzofuran-3,2'-oxane] |
| SMILES | CCCCOC[C@H]1O[C@]2(OCc3ccccc32)[C@H](OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C29H48O6/c1-5-9-17-30-22-25-26(31-18-10-6-2)27(32-19-11-7-3)28(33-20-12-8-4)29(35-25)24-16-14-13-15-23(24)21-34-29/h13-16,25-28H,5-12,17-22H2,1-4H3/t25-,26-,27+,28-,29+/m1/s1 |
| InChIKey | XYIKDLXYQUKNNJ-RQKPWJHBSA-N |
| XLogP | 6.14 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.70 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|