C31H50O7S — CID 88580827
(3S,3'R,4'S,5'R,6'R)-3',4',5'-tributoxy-6'-(butoxymethyl)-6-methylsulfanylspiro[1H-2-benzofuran-3,2'-oxane]-5-carbaldehyde (PubChem CID 88580827) has the molecular formula C31H50O7S and a molecular weight of 566.80 g/mol. Its IUPAC name is (3S,3'R,4'S,5'R,6'R)-3',4',5'-tributoxy-6'-(butoxymethyl)-6-methylsulfanylspiro[1H-2-benzofuran-3,2'-oxane]-5-carbaldehyde.
| Compound Name | (3S,3'R,4'S,5'R,6'R)-3',4',5'-tributoxy-6'-(butoxymethyl)-6-methylsulfanylspiro[1H-2-benzofuran-3,2'-oxane]-5-carbaldehyde |
|---|---|
| PubChem CID | 88580827 |
| Molecular Formula | C31H50O7S |
| Molecular Weight | 566.80 g/mol |
| Exact Mass | 566.33 |
| IUPAC Name | (3S,3'R,4'S,5'R,6'R)-3',4',5'-tributoxy-6'-(butoxymethyl)-6-methylsulfanylspiro[1H-2-benzofuran-3,2'-oxane]-5-carbaldehyde |
| SMILES | CCCCOC[C@H]1O[C@]2(OCc3cc(SC)c(C=O)cc32)[C@H](OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C31H50O7S/c1-6-10-14-33-22-26-28(34-15-11-7-2)29(35-16-12-8-3)30(36-17-13-9-4)31(38-26)25-18-23(20-32)27(39-5)19-24(25)21-37-31/h18-20,26,28-30H,6-17,21-22H2,1-5H3/t26-,28-,29+,30-,31+/m1/s1 |
| InChIKey | WPRSAWCWXGIYBM-VYYBUWSNSA-N |
| XLogP | 6.68 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.80 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|