C19H34O5 — CID 89032568
(3R)-3,4-dibutoxy-2-(butoxymethyl)-3,4-dihydro-2H-pyran-6-carbaldehyde (PubChem CID 89032568) has the molecular formula C19H34O5 and a molecular weight of 342.48 g/mol. Its IUPAC name is (3R)-3,4-dibutoxy-2-(butoxymethyl)-3,4-dihydro-2H-pyran-6-carbaldehyde.
| Compound Name | (3R)-3,4-dibutoxy-2-(butoxymethyl)-3,4-dihydro-2H-pyran-6-carbaldehyde |
|---|---|
| PubChem CID | 89032568 |
| Molecular Formula | C19H34O5 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | (3R)-3,4-dibutoxy-2-(butoxymethyl)-3,4-dihydro-2H-pyran-6-carbaldehyde |
| SMILES | CCCCOCC1OC(C=O)=CC(OCCCC)[C@H]1OCCCC |
| InChI | InChI=1S/C19H34O5/c1-4-7-10-21-15-18-19(23-12-9-6-3)17(22-11-8-5-2)13-16(14-20)24-18/h13-14,17-19H,4-12,15H2,1-3H3/t17?,18?,19-/m1/s1 |
| InChIKey | LAWXOBDPJBEDNH-CTWPCTMYSA-N |
| XLogP | 3.66 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|