C20H36F2O4 — CID 70793086
(2S,3R,4S,5R)-4,5-dibutoxy-2-(butoxymethyl)-6-(difluoromethylidene)-3-methyloxane (PubChem CID 70793086) has the molecular formula C20H36F2O4 and a molecular weight of 378.50 g/mol. Its IUPAC name is (2S,3R,4S,5R)-4,5-dibutoxy-2-(butoxymethyl)-6-(difluoromethylidene)-3-methyloxane.
| Compound Name | (2S,3R,4S,5R)-4,5-dibutoxy-2-(butoxymethyl)-6-(difluoromethylidene)-3-methyloxane |
|---|---|
| PubChem CID | 70793086 |
| Molecular Formula | C20H36F2O4 |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | (2S,3R,4S,5R)-4,5-dibutoxy-2-(butoxymethyl)-6-(difluoromethylidene)-3-methyloxane |
| SMILES | CCCCOC[C@H]1OC(=C(F)F)[C@H](OCCCC)[C@@H](OCCCC)C1C |
| InChI | InChI=1S/C20H36F2O4/c1-5-8-11-23-14-16-15(4)17(24-12-9-6-2)18(25-13-10-7-3)19(26-16)20(21)22/h15-18H,5-14H2,1-4H3/t15?,16-,17+,18-/m1/s1 |
| InChIKey | YXXZVGAWHDBXLN-HQSKLWIPSA-N |
| XLogP | 5.32 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|