C29H47FO5 — CID 173475707
(2R,3R,4S,5R)-3,4,5-tributoxy-2-(butoxymethyl)-6-[fluoro(phenyl)methylidene]oxane (PubChem CID 173475707) has the molecular formula C29H47FO5 and a molecular weight of 494.69 g/mol. Its IUPAC name is (2R,3R,4S,5R)-3,4,5-tributoxy-2-(butoxymethyl)-6-[fluoro(phenyl)methylidene]oxane.
| Compound Name | (2R,3R,4S,5R)-3,4,5-tributoxy-2-(butoxymethyl)-6-[fluoro(phenyl)methylidene]oxane |
|---|---|
| PubChem CID | 173475707 |
| Molecular Formula | C29H47FO5 |
| Molecular Weight | 494.69 g/mol |
| Exact Mass | 494.34 |
| IUPAC Name | (2R,3R,4S,5R)-3,4,5-tributoxy-2-(butoxymethyl)-6-[fluoro(phenyl)methylidene]oxane |
| SMILES | CCCCOC[C@H]1OC(=C(F)c2ccccc2)C(OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C29H47FO5/c1-5-9-18-31-22-24-26(32-19-10-6-2)28(33-20-11-7-3)29(34-21-12-8-4)27(35-24)25(30)23-16-14-13-15-17-23/h13-17,24,26,28-29H,5-12,18-22H2,1-4H3/t24-,26-,28+,29?/m1/s1 |
| InChIKey | QJVGHMIMZRATQT-FWOAYDLFSA-N |
| XLogP | 7.10 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.69 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|