C36H57ClO7 — CID 88570343
[(E,2Z)-2-(1-chloroethylidene)-4-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]pent-3-enyl] benzoate (PubChem CID 88570343) has the molecular formula C36H57ClO7 and a molecular weight of 637.30 g/mol. Its IUPAC name is [(E,2Z)-2-(1-chloroethylidene)-4-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]pent-3-enyl] benzoate.
| Compound Name | [(E,2Z)-2-(1-chloroethylidene)-4-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]pent-3-enyl] benzoate |
|---|---|
| PubChem CID | 88570343 |
| Molecular Formula | C36H57ClO7 |
| Molecular Weight | 637.30 g/mol |
| Exact Mass | 636.38 |
| IUPAC Name | [(E,2Z)-2-(1-chloroethylidene)-4-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]pent-3-enyl] benzoate |
| SMILES | CCCCOC[C@H]1O[C@@H](/C(C)=C/C(COC(=O)c2ccccc2)=C(\C)Cl)C(OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C36H57ClO7/c1-7-11-20-39-26-31-33(40-21-12-8-2)35(42-23-14-10-4)34(41-22-13-9-3)32(44-31)27(5)24-30(28(6)37)25-43-36(38)29-18-16-15-17-19-29/h15-19,24,31-35H,7-14,20-23,25-26H2,1-6H3/b27-24+,30-28-/t31-,32+,33-,34?,35+/m1/s1 |
| InChIKey | IUSVASNSUHEVIB-VQUOZOLMSA-N |
| XLogP | 8.44 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.30 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|