C19H35FO4 — CID 67522411
(2R,3R,4R,5S)-3,5-dibutoxy-2-(butoxymethyl)-4-fluoro-6-methylideneoxane (PubChem CID 67522411) has the molecular formula C19H35FO4 and a molecular weight of 346.48 g/mol. Its IUPAC name is (2R,3R,4R,5S)-3,5-dibutoxy-2-(butoxymethyl)-4-fluoro-6-methylideneoxane.
| Compound Name | (2R,3R,4R,5S)-3,5-dibutoxy-2-(butoxymethyl)-4-fluoro-6-methylideneoxane |
|---|---|
| PubChem CID | 67522411 |
| Molecular Formula | C19H35FO4 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | (2R,3R,4R,5S)-3,5-dibutoxy-2-(butoxymethyl)-4-fluoro-6-methylideneoxane |
| SMILES | C=C1O[C@H](COCCCC)[C@@H](OCCCC)[C@@H](F)[C@H]1OCCCC |
| InChI | InChI=1S/C19H35FO4/c1-5-8-11-21-14-16-19(23-13-10-7-3)17(20)18(15(4)24-16)22-12-9-6-2/h16-19H,4-14H2,1-3H3/t16-,17+,18+,19-/m1/s1 |
| InChIKey | YGXXTYCIMKBCOL-YDZRNGNQSA-N |
| XLogP | 4.42 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|