C22H38FN3O5 — CID 90339254
4-amino-1-[(2R,3S,5R)-4-butoxy-5-(butoxymethyl)-3-fluorooxolan-2-yl]-5-(butoxymethyl)pyrimidin-2-one (PubChem CID 90339254) has the molecular formula C22H38FN3O5 and a molecular weight of 443.56 g/mol. Its IUPAC name is 4-amino-1-[(2R,3S,5R)-4-butoxy-5-(butoxymethyl)-3-fluorooxolan-2-yl]-5-(butoxymethyl)pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,3S,5R)-4-butoxy-5-(butoxymethyl)-3-fluorooxolan-2-yl]-5-(butoxymethyl)pyrimidin-2-one |
|---|---|
| PubChem CID | 90339254 |
| Molecular Formula | C22H38FN3O5 |
| Molecular Weight | 443.56 g/mol |
| Exact Mass | 443.28 |
| IUPAC Name | 4-amino-1-[(2R,3S,5R)-4-butoxy-5-(butoxymethyl)-3-fluorooxolan-2-yl]-5-(butoxymethyl)pyrimidin-2-one |
| SMILES | CCCCOCc1cn([C@@H]2O[C@H](COCCCC)C(OCCCC)[C@@H]2F)c(=O)nc1N |
| InChI | InChI=1S/C22H38FN3O5/c1-4-7-10-28-14-16-13-26(22(27)25-20(16)24)21-18(23)19(30-12-9-6-3)17(31-21)15-29-11-8-5-2/h13,17-19,21H,4-12,14-15H2,1-3H3,(H2,24,25,27)/t17-,18+,19?,21-/m1/s1 |
| InChIKey | LYMUKOMXFONRAM-KXZRCVDZSA-N |
| XLogP | 3.38 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.56 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|