C15H28O9 — CID 73196468
3,4,5-tris(methoxymethoxy)-2-(methoxymethoxymethyl)-6-methylideneoxane (PubChem CID 73196468) has the molecular formula C15H28O9 and a molecular weight of 352.38 g/mol. Its IUPAC name is 3,4,5-tris(methoxymethoxy)-2-(methoxymethoxymethyl)-6-methylideneoxane.
| Compound Name | 3,4,5-tris(methoxymethoxy)-2-(methoxymethoxymethyl)-6-methylideneoxane |
|---|---|
| PubChem CID | 73196468 |
| Molecular Formula | C15H28O9 |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 3,4,5-tris(methoxymethoxy)-2-(methoxymethoxymethyl)-6-methylideneoxane |
| SMILES | C=C1OC(COCOC)C(OCOC)C(OCOC)C1OCOC |
| InChI | InChI=1S/C15H28O9/c1-11-13(21-8-17-3)15(23-10-19-5)14(22-9-18-4)12(24-11)6-20-7-16-2/h12-15H,1,6-10H2,2-5H3 |
| InChIKey | CPQQFRPRMKVTHZ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|