C10H16O4 — CID 11356099
(3E,4S,5R)-3-ethylidene-5-(methoxymethoxymethyl)-4-methyloxolan-2-one (PubChem CID 11356099) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is (3E,4S,5R)-3-ethylidene-5-(methoxymethoxymethyl)-4-methyloxolan-2-one.
| Compound Name | (3E,4S,5R)-3-ethylidene-5-(methoxymethoxymethyl)-4-methyloxolan-2-one |
|---|---|
| PubChem CID | 11356099 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (3E,4S,5R)-3-ethylidene-5-(methoxymethoxymethyl)-4-methyloxolan-2-one |
| SMILES | C/C=C1/C(=O)O[C@@H](COCOC)[C@H]1C |
| InChI | InChI=1S/C10H16O4/c1-4-8-7(2)9(14-10(8)11)5-13-6-12-3/h4,7,9H,5-6H2,1-3H3/b8-4+/t7-,9-/m0/s1 |
| InChIKey | SUSOJAWYAWLIDB-UPZXOSSISA-N |
| XLogP | 1.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|