C7H12O5 — CID 18353942
4,5-bis(methoxymethyl)-1,3-dioxolan-2-one (PubChem CID 18353942) has the molecular formula C7H12O5 and a molecular weight of 176.17 g/mol. Its IUPAC name is 4,5-bis(methoxymethyl)-1,3-dioxolan-2-one.
| Compound Name | 4,5-bis(methoxymethyl)-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 18353942 |
| Molecular Formula | C7H12O5 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 4,5-bis(methoxymethyl)-1,3-dioxolan-2-one |
| SMILES | COCC1OC(=O)OC1COC |
| InChI | InChI=1S/C7H12O5/c1-9-3-5-6(4-10-2)12-7(8)11-5/h5-6H,3-4H2,1-2H3 |
| InChIKey | VTGNJNVVVLCURW-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |