C14H20O5 — CID 102065732
(2R,3R,5R)-2-(methoxymethoxymethyl)-5-phenylmethoxyoxolan-3-ol (PubChem CID 102065732) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is (2R,3R,5R)-2-(methoxymethoxymethyl)-5-phenylmethoxyoxolan-3-ol.
| Compound Name | (2R,3R,5R)-2-(methoxymethoxymethyl)-5-phenylmethoxyoxolan-3-ol |
|---|---|
| PubChem CID | 102065732 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | (2R,3R,5R)-2-(methoxymethoxymethyl)-5-phenylmethoxyoxolan-3-ol |
| SMILES | COCOC[C@H]1O[C@@H](OCc2ccccc2)C[C@H]1O |
| InChI | InChI=1S/C14H20O5/c1-16-10-17-9-13-12(15)7-14(19-13)18-8-11-5-3-2-4-6-11/h2-6,12-15H,7-10H2,1H3/t12-,13-,14-/m1/s1 |
| InChIKey | XFKSGALVKZKUKW-MGPQQGTHSA-N |
| XLogP | 1.30 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|