C32H38O9 — CID 11649844
(3R,4S,5S)-3,4-bis(2-methoxyethoxymethoxy)-5-(trityloxymethyl)oxolan-2-one (PubChem CID 11649844) has the molecular formula C32H38O9 and a molecular weight of 566.65 g/mol. Its IUPAC name is (3R,4S,5S)-3,4-bis(2-methoxyethoxymethoxy)-5-(trityloxymethyl)oxolan-2-one.
| Compound Name | (3R,4S,5S)-3,4-bis(2-methoxyethoxymethoxy)-5-(trityloxymethyl)oxolan-2-one |
|---|---|
| PubChem CID | 11649844 |
| Molecular Formula | C32H38O9 |
| Molecular Weight | 566.65 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | (3R,4S,5S)-3,4-bis(2-methoxyethoxymethoxy)-5-(trityloxymethyl)oxolan-2-one |
| SMILES | COCCOCO[C@H]1[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)OC(=O)[C@@H]1OCOCCOC |
| InChI | InChI=1S/C32H38O9/c1-34-18-20-36-23-38-29-28(41-31(33)30(29)39-24-37-21-19-35-2)22-40-32(25-12-6-3-7-13-25,26-14-8-4-9-15-26)27-16-10-5-11-17-27/h3-17,28-30H,18-24H2,1-2H3/t28-,29-,30+/m0/s1 |
| InChIKey | PDAAQQWFNOGTRH-OIFRRMEBSA-N |
| XLogP | 3.93 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.65 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|