C29H33NO7 — CID 10767913
(3R,4S,5S,6R)-5-hydroxy-3,4-bis(methoxymethoxy)-6-(trityloxymethyl)piperidin-2-one (PubChem CID 10767913) has the molecular formula C29H33NO7 and a molecular weight of 507.58 g/mol. Its IUPAC name is (3R,4S,5S,6R)-5-hydroxy-3,4-bis(methoxymethoxy)-6-(trityloxymethyl)piperidin-2-one.
| Compound Name | (3R,4S,5S,6R)-5-hydroxy-3,4-bis(methoxymethoxy)-6-(trityloxymethyl)piperidin-2-one |
|---|---|
| PubChem CID | 10767913 |
| Molecular Formula | C29H33NO7 |
| Molecular Weight | 507.58 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | (3R,4S,5S,6R)-5-hydroxy-3,4-bis(methoxymethoxy)-6-(trityloxymethyl)piperidin-2-one |
| SMILES | COCO[C@H]1[C@@H](O)[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)NC(=O)[C@@H]1OCOC |
| InChI | InChI=1S/C29H33NO7/c1-33-19-35-26-25(31)24(30-28(32)27(26)36-20-34-2)18-37-29(21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-17,24-27,31H,18-20H2,1-2H3,(H,30,32)/t24-,25+,26+,27-/m1/s1 |
| InChIKey | BRNVEMJJOVDKGJ-LGTXBLIGSA-N |
| XLogP | 2.83 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.58 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|