C17H34O5P+ — CID 71039148
(4S,5S,6R)-4,5-dibutoxy-6-(butoxymethyl)oxaphosphinan-2-ium 2-oxide (PubChem CID 71039148) has the molecular formula C17H34O5P+ and a molecular weight of 349.43 g/mol. Its IUPAC name is (4S,5S,6R)-4,5-dibutoxy-6-(butoxymethyl)oxaphosphinan-2-ium 2-oxide.
| Compound Name | (4S,5S,6R)-4,5-dibutoxy-6-(butoxymethyl)oxaphosphinan-2-ium 2-oxide |
|---|---|
| PubChem CID | 71039148 |
| Molecular Formula | C17H34O5P+ |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | (4S,5S,6R)-4,5-dibutoxy-6-(butoxymethyl)oxaphosphinan-2-ium 2-oxide |
| SMILES | CCCCOC[C@H]1O[P+](=O)C[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C17H34O5P/c1-4-7-10-19-13-15-17(21-12-9-6-3)16(14-23(18)22-15)20-11-8-5-2/h15-17H,4-14H2,1-3H3/q+1/t15-,16-,17-/m1/s1 |
| InChIKey | RJWLEYLAPWAGIU-BRWVUGGUSA-N |
| XLogP | 4.31 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|