C19H38O3 — CID 71267912
(1R,2R,3R)-1,2-dibutoxy-3-(butoxymethyl)cyclohexane (PubChem CID 71267912) has the molecular formula C19H38O3 and a molecular weight of 314.51 g/mol. Its IUPAC name is (1R,2R,3R)-1,2-dibutoxy-3-(butoxymethyl)cyclohexane.
| Compound Name | (1R,2R,3R)-1,2-dibutoxy-3-(butoxymethyl)cyclohexane |
|---|---|
| PubChem CID | 71267912 |
| Molecular Formula | C19H38O3 |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.28 |
| IUPAC Name | (1R,2R,3R)-1,2-dibutoxy-3-(butoxymethyl)cyclohexane |
| SMILES | CCCCOC[C@H]1CCC[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C19H38O3/c1-4-7-13-20-16-17-11-10-12-18(21-14-8-5-2)19(17)22-15-9-6-3/h17-19H,4-16H2,1-3H3/t17-,18-,19-/m1/s1 |
| InChIKey | SEUHNJIWHNMDOA-GUDVDZBRSA-N |
| XLogP | 4.97 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|