C52H50O6S — CID 59488803
(3'R,4'S,5S,5'R,6'R)-3-[(4-ethylphenyl)methyl]-3',4',5'-tris(phenylmethoxy)-6'-(phenylmethoxymethyl)spiro[7H-thieno[3,2-f][2]benzofuran-5,2'-oxane] (PubChem CID 59488803) has the molecular formula C52H50O6S and a molecular weight of 803.03 g/mol. Its IUPAC name is (3'R,4'S,5S,5'R,6'R)-3-[(4-ethylphenyl)methyl]-3',4',5'-tris(phenylmethoxy)-6'-(phenylmethoxymethyl)spiro[7H-thieno[3,2-f][2]benzofuran-5,2'-oxane].
| Compound Name | (3'R,4'S,5S,5'R,6'R)-3-[(4-ethylphenyl)methyl]-3',4',5'-tris(phenylmethoxy)-6'-(phenylmethoxymethyl)spiro[7H-thieno[3,2-f][2]benzofuran-5,2'-oxane] |
|---|---|
| PubChem CID | 59488803 |
| Molecular Formula | C52H50O6S |
| Molecular Weight | 803.03 g/mol |
| Exact Mass | 802.33 |
| IUPAC Name | (3'R,4'S,5S,5'R,6'R)-3-[(4-ethylphenyl)methyl]-3',4',5'-tris(phenylmethoxy)-6'-(phenylmethoxymethyl)spiro[7H-thieno[3,2-f][2]benzofuran-5,2'-oxane] |
| SMILES | CCc1ccc(Cc2csc3cc4c(cc23)[C@]2(OC4)O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C52H50O6S/c1-2-37-23-25-38(26-24-37)27-44-36-59-48-28-43-34-57-52(46(43)29-45(44)48)51(56-33-42-21-13-6-14-22-42)50(55-32-41-19-11-5-12-20-41)49(54-31-40-17-9-4-10-18-40)47(58-52)35-53-30-39-15-7-3-8-16-39/h3-26,28-29,36,47,49-51H,2,27,30-35H2,1H3/t47-,49-,50+,51-,52+/m1/s1 |
| InChIKey | UWYSCVYAPILTIA-WYCSEUNKSA-N |
| XLogP | 11.11 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.03 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |