C51H48O6 — CID 87227148
(3S,3'R,4'S,5'S,6'R)-5-[(4-ethynylphenyl)methyl]-6-methyl-3',4',5'-tris(phenylmethoxy)-6'-(phenylmethoxymethyl)spiro[1H-2-benzofuran-3,2'-oxane] (PubChem CID 87227148) has the molecular formula C51H48O6 and a molecular weight of 756.94 g/mol. Its IUPAC name is (3S,3'R,4'S,5'S,6'R)-5-[(4-ethynylphenyl)methyl]-6-methyl-3',4',5'-tris(phenylmethoxy)-6'-(phenylmethoxymethyl)spiro[1H-2-benzofuran-3,2'-oxane].
| Compound Name | (3S,3'R,4'S,5'S,6'R)-5-[(4-ethynylphenyl)methyl]-6-methyl-3',4',5'-tris(phenylmethoxy)-6'-(phenylmethoxymethyl)spiro[1H-2-benzofuran-3,2'-oxane] |
|---|---|
| PubChem CID | 87227148 |
| Molecular Formula | C51H48O6 |
| Molecular Weight | 756.94 g/mol |
| Exact Mass | 756.35 |
| IUPAC Name | (3S,3'R,4'S,5'S,6'R)-5-[(4-ethynylphenyl)methyl]-6-methyl-3',4',5'-tris(phenylmethoxy)-6'-(phenylmethoxymethyl)spiro[1H-2-benzofuran-3,2'-oxane] |
| SMILES | C#Cc1ccc(Cc2cc3c(cc2C)CO[C@]32O[C@H](COCc3ccccc3)[C@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C51H48O6/c1-3-38-24-26-39(27-25-38)29-44-30-46-45(28-37(44)2)35-56-51(46)50(55-34-43-22-14-7-15-23-43)49(54-33-42-20-12-6-13-21-42)48(53-32-41-18-10-5-11-19-41)47(57-51)36-52-31-40-16-8-4-9-17-40/h1,4-28,30,47-50H,29,31-36H2,2H3/t47-,48+,49+,50-,51+/m1/s1 |
| InChIKey | HDVOGABZRCDMGQ-SVASUFRFSA-N |
| XLogP | 9.62 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.94 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|