C35H34O6 — CID 134469466
(3S,3'R,4'S,5'R,6'R)-6'-methyl-3',4',5'-tris(phenylmethoxy)spiro[1H-2-benzofuran-3,2'-oxane]-5-carbaldehyde (PubChem CID 134469466) has the molecular formula C35H34O6 and a molecular weight of 550.65 g/mol. Its IUPAC name is (3S,3'R,4'S,5'R,6'R)-6'-methyl-3',4',5'-tris(phenylmethoxy)spiro[1H-2-benzofuran-3,2'-oxane]-5-carbaldehyde.
| Compound Name | (3S,3'R,4'S,5'R,6'R)-6'-methyl-3',4',5'-tris(phenylmethoxy)spiro[1H-2-benzofuran-3,2'-oxane]-5-carbaldehyde |
|---|---|
| PubChem CID | 134469466 |
| Molecular Formula | C35H34O6 |
| Molecular Weight | 550.65 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | (3S,3'R,4'S,5'R,6'R)-6'-methyl-3',4',5'-tris(phenylmethoxy)spiro[1H-2-benzofuran-3,2'-oxane]-5-carbaldehyde |
| SMILES | C[C@H]1O[C@]2(OCc3ccc(C=O)cc32)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C35H34O6/c1-25-32(37-21-26-11-5-2-6-12-26)33(38-22-27-13-7-3-8-14-27)34(39-23-28-15-9-4-10-16-28)35(41-25)31-19-29(20-36)17-18-30(31)24-40-35/h2-20,25,32-34H,21-24H2,1H3/t25-,32-,33+,34-,35+/m1/s1 |
| InChIKey | UQFGGJWMFDUJCX-QYXUXFTBSA-N |
| XLogP | 6.36 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.65 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|