C45H52O10 — CID 67419382
[(2S,3R,4R,5S,6S)-2-[(2R,3R,4R,5S,6S)-2-hydroxy-6-methyl-4,5-bis(phenylmethoxy)oxan-3-yl]oxy-6-methyl-4,5-bis(phenylmethoxy)-2-prop-2-enyloxan-3-yl] acetate (PubChem CID 67419382) has the molecular formula C45H52O10 and a molecular weight of 752.90 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6S)-2-[(2R,3R,4R,5S,6S)-2-hydroxy-6-methyl-4,5-bis(phenylmethoxy)oxan-3-yl]oxy-6-methyl-4,5-bis(phenylmethoxy)-2-prop-2-enyloxan-3-yl] acetate.
| Compound Name | [(2S,3R,4R,5S,6S)-2-[(2R,3R,4R,5S,6S)-2-hydroxy-6-methyl-4,5-bis(phenylmethoxy)oxan-3-yl]oxy-6-methyl-4,5-bis(phenylmethoxy)-2-prop-2-enyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 67419382 |
| Molecular Formula | C45H52O10 |
| Molecular Weight | 752.90 g/mol |
| Exact Mass | 752.36 |
| IUPAC Name | [(2S,3R,4R,5S,6S)-2-[(2R,3R,4R,5S,6S)-2-hydroxy-6-methyl-4,5-bis(phenylmethoxy)oxan-3-yl]oxy-6-methyl-4,5-bis(phenylmethoxy)-2-prop-2-enyloxan-3-yl] acetate |
| SMILES | C=CC[C@@]1(O[C@@H]2[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](C)O[C@H]2O)O[C@@H](C)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C45H52O10/c1-5-26-45(55-42-40(50-29-36-22-14-8-15-23-36)38(31(2)52-44(42)47)48-27-34-18-10-6-11-19-34)43(53-33(4)46)41(51-30-37-24-16-9-17-25-37)39(32(3)54-45)49-28-35-20-12-7-13-21-35/h5-25,31-32,38-44,47H,1,26-30H2,2-4H3/t31-,32-,38-,39-,40+,41+,42+,43+,44+,45-/m0/s1 |
| InChIKey | AUYWVTULEOKAOL-CKXCRCTKSA-N |
| XLogP | 7.07 |
| TPSA | 111.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.90 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|