C46H44O7 — CID 59488790
[(3S,3'R,4'S,5'R,6'R)-3',4',5'-tris(phenylmethoxy)-6'-(phenylmethoxymethyl)spiro[1H-benzo[e][2]benzofuran-3,2'-oxane]-6-yl]methanol (PubChem CID 59488790) has the molecular formula C46H44O7 and a molecular weight of 708.85 g/mol. Its IUPAC name is [(3S,3'R,4'S,5'R,6'R)-3',4',5'-tris(phenylmethoxy)-6'-(phenylmethoxymethyl)spiro[1H-benzo[e][2]benzofuran-3,2'-oxane]-6-yl]methanol.
| Compound Name | [(3S,3'R,4'S,5'R,6'R)-3',4',5'-tris(phenylmethoxy)-6'-(phenylmethoxymethyl)spiro[1H-benzo[e][2]benzofuran-3,2'-oxane]-6-yl]methanol |
|---|---|
| PubChem CID | 59488790 |
| Molecular Formula | C46H44O7 |
| Molecular Weight | 708.85 g/mol |
| Exact Mass | 708.31 |
| IUPAC Name | [(3S,3'R,4'S,5'R,6'R)-3',4',5'-tris(phenylmethoxy)-6'-(phenylmethoxymethyl)spiro[1H-benzo[e][2]benzofuran-3,2'-oxane]-6-yl]methanol |
| SMILES | OCc1cccc2c3c(ccc12)[C@]1(OC3)O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C46H44O7/c47-26-37-22-13-23-39-38(37)24-25-41-40(39)31-52-46(41)45(51-30-36-20-11-4-12-21-36)44(50-29-35-18-9-3-10-19-35)43(49-28-34-16-7-2-8-17-34)42(53-46)32-48-27-33-14-5-1-6-15-33/h1-25,42-45,47H,26-32H2/t42-,43-,44+,45-,46+/m1/s1 |
| InChIKey | XXVNCGORIMSDBW-PSKPMRIASA-N |
| XLogP | 8.39 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.85 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |