C46H48O8P2 — CID 59488835
(3R,4S,5R,6R)-2-[1,5-bis(phosphanyloxymethyl)naphthalen-2-yl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol (PubChem CID 59488835) has the molecular formula C46H48O8P2 and a molecular weight of 790.83 g/mol. Its IUPAC name is (3R,4S,5R,6R)-2-[1,5-bis(phosphanyloxymethyl)naphthalen-2-yl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol.
| Compound Name | (3R,4S,5R,6R)-2-[1,5-bis(phosphanyloxymethyl)naphthalen-2-yl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol |
|---|---|
| PubChem CID | 59488835 |
| Molecular Formula | C46H48O8P2 |
| Molecular Weight | 790.83 g/mol |
| Exact Mass | 790.28 |
| IUPAC Name | (3R,4S,5R,6R)-2-[1,5-bis(phosphanyloxymethyl)naphthalen-2-yl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol |
| SMILES | OC1(c2ccc3c(COP)cccc3c2COP)O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C46H48O8P2/c47-46(41-25-24-38-37(30-52-55)22-13-23-39(38)40(41)31-53-56)45(51-29-36-20-11-4-12-21-36)44(50-28-35-18-9-3-10-19-35)43(49-27-34-16-7-2-8-17-34)42(54-46)32-48-26-33-14-5-1-6-15-33/h1-25,42-45,47H,26-32,55-56H2/t42-,43-,44+,45-,46?/m1/s1 |
| InChIKey | NYLVQZQQLQGVCB-FNGPDGFESA-N |
| XLogP | 8.97 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.83 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|